4-[[2-(4-chlorophenoxy)acetyl]amino]benzoic acid
Modify Date: 2024-04-01 19:52:03
![4-[[2-(4-chlorophenoxy)acetyl]amino]benzoic acid Structure](https://image.chemsrc.com/caspic/184/54393-15-6.png)
4-[[2-(4-chlorophenoxy)acetyl]amino]benzoic acid structure
|
Common Name | 4-[[2-(4-chlorophenoxy)acetyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 54393-15-6 | Molecular Weight | 305.71300 | |
| Density | 1.419g/cm3 | Boiling Point | 576.2ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.3ºC | |
| Name | 4-[[2-(4-chlorophenoxy)acetyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 576.2ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.71300 |
| Flash Point | 302.3ºC |
| Exact Mass | 305.04500 |
| PSA | 75.63000 |
| LogP | 3.12870 |
| Index of Refraction | 1.65 |
| InChIKey | QIOBRXCJIOTMBM-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1ccc(C(=O)O)cc1 |
|
~%
4-[[2-(4-chloro... CAS#:54393-15-6 |
| Literature: Krewson et al. Journal of Agricultural and Food Chemistry, 1959 , vol. 7, p. 118,120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(((4-Chlorophenoxy)acetyl)amino)benzoic acid |
| Benzoic acid,4-(((4-chlorophenoxy)acetyl)amino) |
| 4-[2-(4-chloro-phenoxy)-acetylamino]-benzoic acid |
| 4-[2-(4-Chlor-phenoxy)-acetylamino]-benzoesaeure |