1-Benzoyl-5-fluorouracil
Modify Date: 2025-09-18 07:51:03
1-Benzoyl-5-fluorouracil structure
|
Common Name | 1-Benzoyl-5-fluorouracil | ||
|---|---|---|---|---|
| CAS Number | 54390-98-6 | Molecular Weight | 234.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzoyl-5-fluoropyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7FN2O3 |
|---|---|
| Molecular Weight | 234.18300 |
| Exact Mass | 234.04400 |
| PSA | 72.19000 |
| LogP | 0.77650 |
| InChIKey | RQNLYAYTZCUHLO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)n1cc(F)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~49%
1-Benzoyl-5-flu... CAS#:54390-98-6 |
| Literature: Lucey, Neil M.; McCormick, Joan E.; McElhinney, R. Stanley Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 795 - 802 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-N-benzoyl-5-fluorouracil |
| N1-Benzoyl-5-fluorouracil |
| 1-benzoyl-5-fluoro-1H-pyrimidine-2,4-dione |
| 1-Benzoyl-5-fluor-uracil |