2-(2-nitroanilino)phenol
Modify Date: 2025-09-20 16:41:05
2-(2-nitroanilino)phenol structure
|
Common Name | 2-(2-nitroanilino)phenol | ||
|---|---|---|---|---|
| CAS Number | 54381-11-2 | Molecular Weight | 230.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-nitroanilino)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10N2O3 |
|---|---|
| Molecular Weight | 230.21900 |
| Exact Mass | 230.06900 |
| PSA | 78.08000 |
| LogP | 3.64020 |
| InChIKey | XRXKXMZZICZXGN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccccc1O |
|
~%
2-(2-nitroanili... CAS#:54381-11-2 |
| Literature: NeuroSearch A/S Patent: US5200422 A1, 1993 ; US 5200422 A |
|
~68%
2-(2-nitroanili... CAS#:54381-11-2 |
| Literature: Wilshire, John F. K. Australian Journal of Chemistry, 1988 , vol. 41, # 6 p. 995 - 1001 |
|
~%
2-(2-nitroanili... CAS#:54381-11-2 |
| Literature: Wilshire, John F. K. Australian Journal of Chemistry, 1988 , vol. 41, # 6 p. 995 - 1001 |
|
~%
2-(2-nitroanili... CAS#:54381-11-2 |
| Literature: Kloetzel et al. Antibiotics Chemotherapy, 1954 , vol. 4, p. 150,152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2'-hydroxy-2-nitro-diphenylamine |
| 2-<(2'-nitrophenyl)amino>AGN-PC-000RI0 |
| 2'-Nitro-2-hydroxy-diphenylamin |
| 2-(2-Nitro-anilino)-phenol |
| N-(2-hydroxyphenyl)-2-nitroaniline |
| Phenol,2-[(2-nitrophenyl)amino] |