1H-Purine-2,6-dione,8-(ethylamino)-3,7-dihydro-1,3,7-trimethyl-
Modify Date: 2025-09-20 17:18:36
1H-Purine-2,6-dione,8-(ethylamino)-3,7-dihydro-1,3,7-trimethyl- structure
|
Common Name | 1H-Purine-2,6-dione,8-(ethylamino)-3,7-dihydro-1,3,7-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 5436-10-2 | Molecular Weight | 237.25800 | |
| Density | 1.39g/cm3 | Boiling Point | 420.5ºC at 760mmHg | |
| Molecular Formula | C10H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | 8-(ethylamino)-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760mmHg |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.25800 |
| Flash Point | 208.1ºC |
| Exact Mass | 237.12300 |
| PSA | 73.85000 |
| Index of Refraction | 1.658 |
| InChIKey | VJLTWKXFDJKGPR-UHFFFAOYSA-N |
| SMILES | CCNc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| HS Code | 2933990090 |
|---|
|
~%
1H-Purine-2,6-d... CAS#:5436-10-2 |
| Literature: Lueppo-Cramer Chemische Berichte, 1894 , vol. 27, p. 3089 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Aethylamino-1,3,7-trimethyl-3,7-dihydro-purin-2,6-dion |
| 8-ethylamino-1,3,7-trimethyl-3,7-dihydro-purine-2,6-dione |