7,9-dihydroxy-6,8-dinitro-5H-benzo[b][1,5]naphthyridin-10-one
Modify Date: 2025-08-28 14:36:12
![7,9-dihydroxy-6,8-dinitro-5H-benzo[b][1,5]naphthyridin-10-one Structure](https://image.chemsrc.com/caspic/063/5435-73-4.png)
7,9-dihydroxy-6,8-dinitro-5H-benzo[b][1,5]naphthyridin-10-one structure
|
Common Name | 7,9-dihydroxy-6,8-dinitro-5H-benzo[b][1,5]naphthyridin-10-one | ||
|---|---|---|---|---|
| CAS Number | 5435-73-4 | Molecular Weight | 318.19900 | |
| Density | 1.846g/cm3 | Boiling Point | 479.4ºC at 760 mmHg | |
| Molecular Formula | C12H6N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | 7,9-dihydroxy-6,8-dinitro-5H-benzo[b][1,5]naphthyridin-10-one |
|---|
| Density | 1.846g/cm3 |
|---|---|
| Boiling Point | 479.4ºC at 760 mmHg |
| Molecular Formula | C12H6N4O7 |
| Molecular Weight | 318.19900 |
| Flash Point | 243.7ºC |
| Exact Mass | 318.02400 |
| PSA | 178.11000 |
| LogP | 2.76260 |
| Index of Refraction | 1.778 |
| InChIKey | ZHGKDBYBYSBOIZ-UHFFFAOYSA-N |
| SMILES | O=c1c2ncccc2[nH]c2c([N+](=O)[O-])c(O)c([N+](=O)[O-])c(O)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |