1,2-Benzisothiazol-3-amine,N,N-diethyl-, 1,1-dioxide
Modify Date: 2025-08-25 17:53:23
1,2-Benzisothiazol-3-amine,N,N-diethyl-, 1,1-dioxide structure
|
Common Name | 1,2-Benzisothiazol-3-amine,N,N-diethyl-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 5435-30-3 | Molecular Weight | 238.30600 | |
| Density | 1.27g/cm3 | Boiling Point | 385.9ºC at 760mmHg | |
| Molecular Formula | C11H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | N,N-diethyl-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 385.9ºC at 760mmHg |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.30600 |
| Flash Point | 187.2ºC |
| Exact Mass | 238.07800 |
| PSA | 58.12000 |
| LogP | 1.99370 |
| Index of Refraction | 1.607 |
| InChIKey | NUWGZZNUFALTCS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NS(=O)(=O)c2ccccc21 |
| HS Code | 2934991000 |
|---|
|
~%
1,2-Benzisothia... CAS#:5435-30-3 |
| Literature: Mehta,S.J.; Hamor,G.H. Journal of Pharmaceutical Sciences, 1961 , vol. 50, p. 672 - 675 |
|
~%
1,2-Benzisothia... CAS#:5435-30-3 |
| Literature: Mehta,S.J.; Hamor,G.H. Journal of Pharmaceutical Sciences, 1961 , vol. 50, p. 672 - 675 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934991000 |
|---|---|
| Summary | 2934991000. sultones and sultams. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Diethylamino-benz<d>isooxazol-1,1-dioxid |
| 1,2-benzisothiazol-3-amine,n,n-diethyl-,1,1-dioxide |