Clofeverine
Modify Date: 2025-08-21 16:58:15
Clofeverine structure
|
Common Name | Clofeverine | ||
|---|---|---|---|---|
| CAS Number | 54340-63-5 | Molecular Weight | 305.75600 | |
| Density | 1.326g/cm3 | Boiling Point | 513.3ºC at 760 mmHg | |
| Molecular Formula | C16H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2ºC | |
| Name | 1-[(4-Chlorophenoxy)methyl]-1,2,3,4-tetrahydro-6,7-isoquinolinedi ol |
|---|
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 513.3ºC at 760 mmHg |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.75600 |
| Flash Point | 264.2ºC |
| Exact Mass | 305.08200 |
| PSA | 61.72000 |
| LogP | 3.34580 |
| Index of Refraction | 1.623 |
| InChIKey | GVALVWDQPXGPCE-UHFFFAOYSA-N |
| SMILES | Oc1cc2c(cc1O)C(COc1ccc(Cl)cc1)NCC2 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |