N',N'-diethyl-N-[2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]ethane-1,2-diamine structure
|
Common Name | N',N'-diethyl-N-[2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 54333-88-9 | Molecular Weight | 380.44000 | |
| Density | 1.252g/cm3 | Boiling Point | 549ºC at 760 mmHg | |
| Molecular Formula | C21H24N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.8ºC | |
| Name | N',N'-diethyl-N-[2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 549ºC at 760 mmHg |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.44000 |
| Flash Point | 285.8ºC |
| Exact Mass | 380.18500 |
| PSA | 87.12000 |
| LogP | 5.25630 |
| Index of Refraction | 1.68 |
| InChIKey | YULMHDDMDPWKHH-ZHACJKMWSA-N |
| SMILES | CCN(CC)CCNc1cccc2ccc(C=Cc3ccc([N+](=O)[O-])o3)nc12 |
|
~%
N',N'-diethyl-N... CAS#:54333-88-9 |
| Literature: Ujiie Chemical and Pharmaceutical Bulletin, 1974 , vol. 22, # 10 p. 2470 - 2475 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-Ethanediamine,N,N-diethyl-N'-(2-(2-(5-nitro-2-furanyl)ethenyl)-8-quinolinyl) |
| N,N-Diethyl-N'-(2-(2-(5-nitro-2-furanyl)ethenyl)-8-quinolinyl)-1,2-ethanediamine |
| N,N-diethyl-N'-{2-[2-(5-nitro-furan-2-yl)-vinyl]-quinolin-8-yl}-ethane-1,2-diamine |