Benzenesulfonamide,4-amino-N-(3,6-dimethyl-2-pyrazinyl)- structure
|
Common Name | Benzenesulfonamide,4-amino-N-(3,6-dimethyl-2-pyrazinyl)- | ||
|---|---|---|---|---|
| CAS Number | 5433-89-6 | Molecular Weight | 278.33000 | |
| Density | 1.392g/cm3 | Boiling Point | 470.5ºC at 760 mmHg | |
| Molecular Formula | C12H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4ºC | |
| Name | 4-amino-N-(3,6-dimethylpyrazin-2-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760 mmHg |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.33000 |
| Flash Point | 238.4ºC |
| Exact Mass | 278.08400 |
| PSA | 106.35000 |
| LogP | 3.21140 |
| Index of Refraction | 1.644 |
| InChIKey | FDHMEYQRNNUMOT-UHFFFAOYSA-N |
| SMILES | Cc1cnc(C)c(NS(=O)(=O)c2ccc(N)cc2)n1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:5433-89-6 |
| Literature: Joiner; Spoerri Journal of the American Chemical Society, 1941 , vol. 63, p. 1929 |
|
~%
Benzenesulfonam... CAS#:5433-89-6 |
| Literature: Joiner; Spoerri Journal of the American Chemical Society, 1941 , vol. 63, p. 1929 |
|
~%
Benzenesulfonam... CAS#:5433-89-6 |
| Literature: Joiner; Spoerri Journal of the American Chemical Society, 1941 , vol. 63, p. 1929 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| sulfanilic acid-(3,6-dimethyl-pyrazin-2-ylamide) |
| 4-Amino-N-(2,5-dimethyl-3-pyrazinyl)benzenesulfonamide |
| Sulfanilsaeure-(3,6-dimethyl-pyrazin-2-ylamid) |