Benzene,1-[(diphenylmethyl)sulfonyl]-2-methyl- structure
|
Common Name | Benzene,1-[(diphenylmethyl)sulfonyl]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5433-77-2 | Molecular Weight | 322.42100 | |
| Density | 1.185g/cm3 | Boiling Point | 517.4ºC at 760mmHg | |
| Molecular Formula | C20H18O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.4ºC | |
| Name | 1-benzhydrylsulfonyl-2-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 517.4ºC at 760mmHg |
| Molecular Formula | C20H18O2S |
| Molecular Weight | 322.42100 |
| Flash Point | 323.4ºC |
| Exact Mass | 322.10300 |
| PSA | 42.52000 |
| LogP | 5.63910 |
| Index of Refraction | 1.609 |
| InChIKey | YFXCMARVWFKTJO-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1S(=O)(=O)C(c1ccccc1)c1ccccc1 |
| HS Code | 2904100000 |
|---|
|
~%
Benzene,1-[(dip... CAS#:5433-77-2 |
| Literature: Gregg et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 6660 |
|
~%
Benzene,1-[(dip... CAS#:5433-77-2 |
| Literature: Gregg et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 6660 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| benzhydryl-o-tolyl sulfone |
| Benzhydryl-o-tolyl-sulfon |
| 1-BENZHYDRYLSULFONYL-2-METHYL-BENZENE |