3-benzamidopropyl benzoate
Modify Date: 2025-09-06 18:14:08
3-benzamidopropyl benzoate structure
|
Common Name | 3-benzamidopropyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 5433-09-0 | Molecular Weight | 283.32200 | |
| Density | 1.156g/cm3 | Boiling Point | 501.9ºC at 760 mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.4ºC | |
| Name | 3-benzamidopropyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 501.9ºC at 760 mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 257.4ºC |
| Exact Mass | 283.12100 |
| PSA | 55.40000 |
| LogP | 3.05440 |
| Index of Refraction | 1.57 |
| InChIKey | OBQHMFRYUQDAAI-UHFFFAOYSA-N |
| SMILES | O=C(NCCCOC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~10%
3-benzamidoprop... CAS#:5433-09-0 |
| Literature: Morcuende, Anabel; Ors, Marta; Valverde, Serafin; Herradon, Berbardo Journal of Organic Chemistry, 1996 , vol. 61, # 16 p. 5264 - 5270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Benzamidopropyl-benzoat |
| N,O-dibenzoyl-3-amino-1-propanol |
| HMS3080M03 |