Benzoicacid, 3-(acetyloxy)-5-(1-piperidinylmethyl)-, methyl ester, hydrochloride (1:1)
Modify Date: 2025-08-26 16:19:42
Benzoicacid, 3-(acetyloxy)-5-(1-piperidinylmethyl)-, methyl ester, hydrochloride (1:1) structure
|
Common Name | Benzoicacid, 3-(acetyloxy)-5-(1-piperidinylmethyl)-, methyl ester, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5432-82-6 | Molecular Weight | 327.80300 | |
| Density | 1.159g/cm3 | Boiling Point | 391.7ºC at 760 mmHg | |
| Molecular Formula | C16H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.7ºC | |
| Name | methyl 3-acetyloxy-5-(piperidin-1-ylmethyl)benzoate,hydrochloride |
|---|
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 391.7ºC at 760 mmHg |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.80300 |
| Flash Point | 190.7ºC |
| Exact Mass | 327.12400 |
| PSA | 55.84000 |
| LogP | 3.12430 |
| Index of Refraction | 1.54 |
| InChIKey | OSZHHJWHHGMLGI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(CN2CCCCC2)cc(OC(C)=O)c1.Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |