1,4-Pentanediamine,N4-[7-chloro-6-[(phenylmethyl)thio]-4-quinolinyl]-N1,N1-diethyl- structure
|
Common Name | 1,4-Pentanediamine,N4-[7-chloro-6-[(phenylmethyl)thio]-4-quinolinyl]-N1,N1-diethyl- | ||
|---|---|---|---|---|
| CAS Number | 5431-08-3 | Molecular Weight | 442.06000 | |
| Density | 1.16g/cm3 | Boiling Point | 586.7ºC at 760 mmHg | |
| Molecular Formula | C25H32ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.6ºC | |
| Name | 4-N-(6-benzylsulfanyl-7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 586.7ºC at 760 mmHg |
| Molecular Formula | C25H32ClN3S |
| Molecular Weight | 442.06000 |
| Flash Point | 308.6ºC |
| Exact Mass | 441.20100 |
| PSA | 53.46000 |
| LogP | 7.17590 |
| Index of Refraction | 1.623 |
| InChIKey | CPNZFAYIRSHTEY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)c(SCc3ccccc3)cc12 |
| HS Code | 2933499090 |
|---|
|
~%
1,4-Pentanediam... CAS#:5431-08-3 |
| Literature: Riegel et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1229,1231 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N4-[7-chloranyl-6-(phenylmethylsulfanyl)quinolin-4-yl]-N1,N1-diethyl-pentane-1,4-diamine |
| n4-[6-(benzylsulfanyl)-7-chloroquinolin-4-yl]-n1,n1-diethylpentane-1,4-diamine |
| N4,N4-diethyl-N1-(6-benzylmercapto-7-chloro-[4]quinolyl)-1-methyl-butanediyldiamine |
| N4,N4-Diaethyl-N1-(6-benzylmercapto-7-chlor-[4]chinolyl)-1-methyl-butandiyldiamin |