Carbamothioic acid,S-[2-(1-naphthalenylamino)-2-oxoethyl] ester
Modify Date: 2025-09-30 13:07:34
![Carbamothioic acid,S-[2-(1-naphthalenylamino)-2-oxoethyl] ester Structure](https://image.chemsrc.com/caspic/227/5430-53-5.png)
Carbamothioic acid,S-[2-(1-naphthalenylamino)-2-oxoethyl] ester structure
|
Common Name | Carbamothioic acid,S-[2-(1-naphthalenylamino)-2-oxoethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 5430-53-5 | Molecular Weight | 260.31200 | |
| Density | 1.385g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[2-(naphthalen-1-ylamino)-2-oxoethyl] carbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.31200 |
| Exact Mass | 260.06200 |
| PSA | 97.49000 |
| LogP | 3.36350 |
| Index of Refraction | 1.724 |
| InChIKey | WIEHBFPIPIMVEK-UHFFFAOYSA-N |
| SMILES | NC(=O)SCC(=O)Nc1cccc2ccccc12 |
| HS Code | 2930200090 |
|---|
| HS Code | 2930200090 |
|---|---|
| Summary | 2930200090 other thiocarbamates and dithiocarbamates。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| carbamoylsulfanyl-acetic acid-[1]naphthylamide |
| Carbamoylmercapto-essigsaeure-[1]naphthylamid |
| C-Carbamoylmercapto-N-(naphthyl-(1))-acetamid |