N,N-dimethyl-1,3-dioxo-isoindole-2-sulfonamide structure
|
Common Name | N,N-dimethyl-1,3-dioxo-isoindole-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5430-46-6 | Molecular Weight | 254.26200 | |
| Density | 1.55g/cm3 | Boiling Point | 420.9ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | N,N-dimethyl-1,3-dioxoisoindole-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760 mmHg |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.26200 |
| Flash Point | 208.3ºC |
| Exact Mass | 254.03600 |
| PSA | 83.14000 |
| LogP | 1.10770 |
| Index of Refraction | 1.654 |
| InChIKey | CVJWLOLCAFRDJX-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C(=O)c2ccccc2C1=O |
| HS Code | 2935009090 |
|---|
|
~%
N,N-dimethyl-1,... CAS#:5430-46-6 |
| Literature: Fuhrman; Degering Journal of the American Chemical Society, 1945 , vol. 67, p. 1245 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| HMS2882L15 |
| N-Dimethylsulfamoyl-phthalimid |
| N-dimethylsulfamoyl-phthalimide |
| N,N-Dimethyl-1,3-dioxo-1,3-dihydro-2H-isoindole-2-sulfonamide |