2-bromo-4-(1,2-dibromo-2-nitroethyl)-6-methoxyphenol
Modify Date: 2025-08-27 14:29:54
2-bromo-4-(1,2-dibromo-2-nitroethyl)-6-methoxyphenol structure
|
Common Name | 2-bromo-4-(1,2-dibromo-2-nitroethyl)-6-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 54291-91-7 | Molecular Weight | 433.87600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Br3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-4-(1,2-dibromo-2-nitroethyl)-6-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8Br3NO4 |
|---|---|
| Molecular Weight | 433.87600 |
| Exact Mass | 430.80000 |
| PSA | 75.28000 |
| LogP | 4.12020 |
| InChIKey | HSWOESDPEIBWCP-UHFFFAOYSA-N |
| SMILES | COc1cc(C(Br)C(Br)[N+](=O)[O-])cc(Br)c1O |
|
~%
2-bromo-4-(1,2-... CAS#:54291-91-7 |
| Literature: Raiford; Fox Journal of Organic Chemistry, 1944 , vol. 9, p. 170,173 |
|
~%
2-bromo-4-(1,2-... CAS#:54291-91-7 |
| Literature: Raiford; Fox Journal of Organic Chemistry, 1944 , vol. 9, p. 170,173 |
![2-Methoxy-4-[(E)-2-nitrovinyl]phenol structure](https://image.chemsrc.com/caspic/233/6178-42-3.png)
![Phenol,2-methoxy-4-[(1E)-2-nitroethenyl]- structure](https://image.chemsrc.com/caspic/025/22568-51-0.png)
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2-bromo-4-(1,2-dibromo-2-nitro-ethyl)-6-methoxy-phenol |
| 2-Brom-4-(1,2-dibrom-2-nitro-aethyl)-6-methoxy-phenol |
| Methyl-[5-brom-6-hydroxy-3-(1.2-dibrom-2-nitro-aethyl)-phenyl]-aether |
| Phenol,2-bromo-4-(1,2-dibromo-2-nitroethyl)-6-methoxy |
| 5-Brom-4-hydroxy-3-methoxy-1-(1.2-dibrom-2-nitro-aethyl)-benzol |