4-methylcyclohexane-1,1-dicarboxylic acid structure
|
Common Name | 4-methylcyclohexane-1,1-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54286-13-4 | Molecular Weight | 186.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylcyclohexane-1,1-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14O4 |
|---|---|
| Molecular Weight | 186.20500 |
| Exact Mass | 186.08900 |
| PSA | 74.60000 |
| LogP | 1.35210 |
| InChIKey | ACTKQYFQQDFDAM-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(=O)O)(C(=O)O)CC1 |
|
~%
4-methylcyclohe... CAS#:54286-13-4 |
| Literature: Price et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 2301 |
|
~%
4-methylcyclohe... CAS#:54286-13-4 |
| Literature: Lewina et al. Zhurnal Obshchei Khimii, 1955 , vol. 25, p. 2522,2525; engl. Ausg. S. 2417, 2419 |
|
~%
4-methylcyclohe... CAS#:54286-13-4 |
| Literature: Lewina et al. Zhurnal Obshchei Khimii, 1955 , vol. 25, p. 2522,2525; engl. Ausg. S. 2417, 2419 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1-Cyclohexanedicarboxylic acid,4-methyl |
| 4-Methyl-cyclohexan-1,1-dicarboxylic acid |
| 3-Methylcyclohexan-1,1-dicarbonsaeure |
| 4-methyl-cyclohexane-1,1-dicarboxylic acid |
| 4-Methyl-cyclohexan-dicarbonsaeure-(1,1) |
| 4-Methyl-cyclohexan-1,1-dicarbonsaeure |