[4,6-dioxo-3,5-bis(phenylhydrazinylidene)-1-cyclohexenyl]arsonic acid
Modify Date: 2025-09-29 05:18:42
![[4,6-dioxo-3,5-bis(phenylhydrazinylidene)-1-cyclohexenyl]arsonic acid Structure](https://image.chemsrc.com/caspic/260/5425-71-8.png)
[4,6-dioxo-3,5-bis(phenylhydrazinylidene)-1-cyclohexenyl]arsonic acid structure
|
Common Name | [4,6-dioxo-3,5-bis(phenylhydrazinylidene)-1-cyclohexenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5425-71-8 | Molecular Weight | 442.25700 | |
| Density | N/A | Boiling Point | 681.9ºC at 760 mmHg | |
| Molecular Formula | C18H15AsN4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 366.2ºC | |
| Name | (2,4-dihydroxy-3,5-bis-phenylazo-phenyl)-arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 681.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H15AsN4O5 |
| Molecular Weight | 442.25700 |
| Flash Point | 366.2ºC |
| Exact Mass | 442.02600 |
| PSA | 147.43000 |
| LogP | 3.48960 |
| InChIKey | NYPYSNUURJEQRR-XRBXDRSNSA-N |
| SMILES | O=c1c([As](=O)(O)O)cc(=NNc2ccccc2)c(=O)c1=NNc1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~%
[4,6-dioxo-3,5-... CAS#:5425-71-8 |
| Literature: Doak; Steinman; Eagle Journal of the American Chemical Society, 1944 , vol. 66, p. 194,196 Journal of the American Chemical Society, 1945 , vol. 67, p. 719 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (2,4-difluoro-phenyl)-tetradecyl ether |
| (2,4-Dihydroxy-3,5-bis-phenylazo-phenyl)-arsonsaeure |
| (2,4-Difluor-phenyl)-tetradecyl-aether |