ethyl (2-cyanophenyl)carbamoylformate structure
|
Common Name | ethyl (2-cyanophenyl)carbamoylformate | ||
|---|---|---|---|---|
| CAS Number | 54249-43-3 | Molecular Weight | 218.20900 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(2-cyanoanilino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Exact Mass | 218.06900 |
| PSA | 79.19000 |
| LogP | 1.13288 |
| Index of Refraction | 1.551 |
| InChIKey | LYNISAGITOKJKO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1ccccc1C#N |
|
~91%
ethyl (2-cyanop... CAS#:54249-43-3 |
| Literature: Kim, Yu Mi; Kim, Sung Hwan; Kim, Jae Nyoung Bulletin of the Korean Chemical Society, 2010 , vol. 31, # 6 p. 1765 - 1768 |
|
~%
ethyl (2-cyanop... CAS#:54249-43-3 |
| Literature: American Home Products Corporation Patent: US3966965 A1, 1976 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2'-Cyanooxanilic acid ethyl ester |
| 2-ethoxalylaminobenzonitrile |
| ethyl [(2-cyanophenyl)amino](oxo)acetate |
| ethyl 2'-cyanooxanilate |
| F2189-0394 |
| 2'-Cyanooxanilsaeure-ethylester |
| ETHYL (2-CYANOPHENYL)CARBAMOYLFORMATE |