2-Hexanone,3,4-bis(4-methoxyphenyl)- structure
|
Common Name | 2-Hexanone,3,4-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5424-88-4 | Molecular Weight | 312.40300 | |
| Density | 1.056g/cm3 | Boiling Point | 414.4ºC at 760mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.1ºC | |
| Name | 3,4-bis(4-methoxyphenyl)hexan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 414.4ºC at 760mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 196.1ºC |
| Exact Mass | 312.17300 |
| PSA | 35.53000 |
| LogP | 4.57020 |
| Index of Refraction | 1.536 |
| InChIKey | MPQKSSUCTJHMMC-UHFFFAOYSA-N |
| SMILES | CCC(c1ccc(OC)cc1)C(C(C)=O)c1ccc(OC)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Hexanone,3,4-bis(4-methoxyphenyl) |
| 3,4-bis-(4-methoxy-phenyl)-hexan-2-one |