(2-methylphenyl) 4-nitrobenzoate
Modify Date: 2025-12-06 12:33:05
(2-methylphenyl) 4-nitrobenzoate structure
|
Common Name | (2-methylphenyl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 5421-45-4 | Molecular Weight | 257.24100 | |
| Density | 1.28g/cm3 | Boiling Point | 454.9ºC at 760 mmHg | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.9ºC | |
| Name | (2-methylphenyl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 454.9ºC at 760 mmHg |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24100 |
| Flash Point | 209.9ºC |
| Exact Mass | 257.06900 |
| PSA | 72.12000 |
| LogP | 3.64560 |
| Index of Refraction | 1.605 |
| InChIKey | JPSZFHPZVGXCEL-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~90%
(2-methylphenyl... CAS#:5421-45-4 |
| Literature: Iranpoor, Nasser; Firouzabadi, Habib; Khalili, Dariush Organic and Biomolecular Chemistry, 2010 , vol. 8, # 19 p. 4436 - 4443 |
|
~90%
(2-methylphenyl... CAS#:5421-45-4 |
| Literature: Hercouet, A.; Corre, M. Le Tetrahedron, 1981 , vol. 37, # 16 p. 2867 - 2874 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-benzoesaeure-o-tolylester |
| Benzoic acid,p-nitro-,o-tolyl ester |
| 4-nitro-benzoic acid o-tolyl ester |
| 2-methylphenyl 4-nitrobenzoate |
| p-nitrobenzoate d'o-tolyle |
| 4-nitro-benzoic acid,2-methylphenyl ester |