1,2-Cyclobutanedicarboxylicacid, 1,2-dibromo-, 1,2-diethyl ester structure
|
Common Name | 1,2-Cyclobutanedicarboxylicacid, 1,2-dibromo-, 1,2-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5420-63-3 | Molecular Weight | 358.02400 | |
| Density | 1.748g/cm3 | Boiling Point | 330.5ºC at 760 mmHg | |
| Molecular Formula | C10H14Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.7ºC | |
| Name | diethyl 1,2-dibromocyclobutane-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.748g/cm3 |
|---|---|
| Boiling Point | 330.5ºC at 760 mmHg |
| Molecular Formula | C10H14Br2O4 |
| Molecular Weight | 358.02400 |
| Flash Point | 153.7ºC |
| Exact Mass | 355.92600 |
| PSA | 52.60000 |
| LogP | 2.17380 |
| Index of Refraction | 1.547 |
| InChIKey | XVDQRPZYIPSGDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(Br)CCC1(Br)C(=O)OCC |
| HS Code | 2917209090 |
|---|
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1,2-dibromo-cyclobutane-1,2-dicarboxylic acid diethyl ester |
| 1,2-Cyclobutanedicarboxylic acid,1,2-dibromo-,diethyl ester,cis |
| 1,2-Dibrom-cyclobutan-1,2-dicarbonsaeure-diaethylester |