2-Propanol,1-[[3-[(7-chloro-4-quinolinyl)amino]propyl]amino]-2-methyl- structure
|
Common Name | 2-Propanol,1-[[3-[(7-chloro-4-quinolinyl)amino]propyl]amino]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5418-57-5 | Molecular Weight | 307.81800 | |
| Density | 1.213g/cm3 | Boiling Point | 508.6ºC at 760mmHg | |
| Molecular Formula | C16H22ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.4ºC | |
| Name | 1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-2-methylpropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 508.6ºC at 760mmHg |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.81800 |
| Flash Point | 261.4ºC |
| Exact Mass | 307.14500 |
| PSA | 57.18000 |
| LogP | 3.51460 |
| Index of Refraction | 1.624 |
| InChIKey | PVGKFEFXDTXWKX-UHFFFAOYSA-N |
| SMILES | CC(C)(O)CNCCCNc1ccnc2cc(Cl)ccc12 |
|
~%
2-Propanol,1-[[... CAS#:5418-57-5 |
| Literature: Steck et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 4063 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-[3-(7-Chlor-[4]chinolylamino)-propylamino]-2-methyl-propan-2-ol |
| 1-[3-(7-chloro-[4]quinolylamino)-propylamino]-2-methyl-propan-2-ol |
| 1-({3-[(7-chloroquinolin-4-yl)amino]propyl}amino)-2-methylpropan-2-ol |