3-chloro-9-methyl-N-tert-butyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine structure
|
Common Name | 3-chloro-9-methyl-N-tert-butyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine | ||
|---|---|---|---|---|
| CAS Number | 5417-87-8 | Molecular Weight | 239.70500 | |
| Density | 1.35g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-tert-butyl-6-chloro-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.70500 |
| Exact Mass | 239.09400 |
| PSA | 55.63000 |
| LogP | 2.30010 |
| Index of Refraction | 1.642 |
| InChIKey | BQWMHPMHSSIKLS-UHFFFAOYSA-N |
| SMILES | Cn1ncc2c(NC(C)(C)C)nc(Cl)nc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| n-tert-butyl-6-chloro-1-methyl-1h-pyrazolo[3,4-d]pyrimidin-4-amine |
| tert-butyl-(6-chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-amine |
| tert-Butyl-(6-chlor-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-amin |