Butanoicacid, 4-oxo-4-[(9-oxo-9H-fluoren-2-yl)amino]- structure
|
Common Name | Butanoicacid, 4-oxo-4-[(9-oxo-9H-fluoren-2-yl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 5416-86-4 | Molecular Weight | 295.28900 | |
| Density | 1.436g/cm3 | Boiling Point | 634ºC at 760mmHg | |
| Molecular Formula | C17H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.2ºC | |
| Name | 4-oxo-4-[(9-oxofluoren-2-yl)amino]butanoic acid |
|---|
| Density | 1.436g/cm3 |
|---|---|
| Boiling Point | 634ºC at 760mmHg |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.28900 |
| Flash Point | 337.2ºC |
| Exact Mass | 295.08400 |
| PSA | 83.47000 |
| LogP | 2.77430 |
| Index of Refraction | 1.695 |
| InChIKey | SGWQINAKRAAGJC-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1-2 |
| HS Code | 2924299090 |
|---|
|
~%
Butanoicacid, 4... CAS#:5416-86-4 |
| Literature: Fletcher et al. Journal of Organic Chemistry, 1955 , vol. 20, p. 1021,1023 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |