1-Bromo-1,2,4,5-tetrahydro-3-benzothiepine 3,3-dioxide
Modify Date: 2025-09-25 18:35:33
1-Bromo-1,2,4,5-tetrahydro-3-benzothiepine 3,3-dioxide structure
|
Common Name | 1-Bromo-1,2,4,5-tetrahydro-3-benzothiepine 3,3-dioxide | ||
|---|---|---|---|---|
| CAS Number | 5411-92-7 | Molecular Weight | 275.16200 | |
| Density | 1.572g/cm3 | Boiling Point | 445.6ºC at 760 mmHg | |
| Molecular Formula | C10H11BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | 5-bromo-1,2,4,5-tetrahydro-3λ6-benzothiepine 3,3-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760 mmHg |
| Molecular Formula | C10H11BrO2S |
| Molecular Weight | 275.16200 |
| Flash Point | 223.3ºC |
| Exact Mass | 273.96600 |
| PSA | 42.52000 |
| LogP | 3.17430 |
| Index of Refraction | 1.598 |
| InChIKey | UMNCWECSMDPDOE-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CCc2ccccc2C(Br)C1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Bromo-1,2,4,5-tetrahydro-3-benzothiepine 3,3-dioxide |
| 5-bromo-1,2,4,5-tetrahydro-3 |