2-(9-oxofluoren-2-yl)isoindole-1,3-dione structure
|
Common Name | 2-(9-oxofluoren-2-yl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5411-65-4 | Molecular Weight | 325.31700 | |
| Density | 1.464g/cm3 | Boiling Point | 585.8ºC at 760 mmHg | |
| Molecular Formula | C21H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.8ºC | |
| Name | 2-(9-oxofluoren-2-yl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 585.8ºC at 760 mmHg |
| Molecular Formula | C21H11NO3 |
| Molecular Weight | 325.31700 |
| Flash Point | 289.8ºC |
| Exact Mass | 325.07400 |
| PSA | 54.45000 |
| LogP | 3.76360 |
| Index of Refraction | 1.741 |
| InChIKey | RTMIPQBNVFXLEJ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2-c2ccc(N3C(=O)c4ccccc4C3=O)cc21 |
|
~%
2-(9-oxofluoren... CAS#:5411-65-4 |
| Literature: Fletcher et al. Journal of Organic Chemistry, 1955 , vol. 20, p. 1021,1023 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(9-oxo-fluoren-2-yl)-phthalimide |
| 2-(9-oxo-9h-fluoren-2-yl)-1h-isoindole-1,3(2h)-dione |