2,2,2-trichloro-1-(2-methylbutan-2-yloxy)ethanol
Modify Date: 2025-10-16 20:18:26
2,2,2-trichloro-1-(2-methylbutan-2-yloxy)ethanol structure
|
Common Name | 2,2,2-trichloro-1-(2-methylbutan-2-yloxy)ethanol | ||
|---|---|---|---|---|
| CAS Number | 541-63-9 | Molecular Weight | 235.53600 | |
| Density | 1.29g/cm3 | Boiling Point | 211.4ºC at 760 mmHg | |
| Molecular Formula | C7H13Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.6ºC | |
| Name | 2,2,2-trichloro-1-(2-methylbutan-2-yloxy)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 211.4ºC at 760 mmHg |
| Molecular Formula | C7H13Cl3O2 |
| Molecular Weight | 235.53600 |
| Flash Point | 81.6ºC |
| Exact Mass | 233.99800 |
| PSA | 29.46000 |
| LogP | 2.88020 |
| Index of Refraction | 1.483 |
| InChIKey | VSYFHDGUUKGQEW-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)OC(O)C(Cl)(Cl)Cl |
| HS Code | 2909499000 |
|---|
|
~%
2,2,2-trichloro... CAS#:541-63-9 |
| Literature: Kalle and Co. Patent: DE115251 ; |
|
~%
2,2,2-trichloro... CAS#:541-63-9 |
| Literature: Kalle and Co. Patent: DE115252 ; |
|
~%
2,2,2-trichloro... CAS#:541-63-9 |
| Literature: Chem.Fabr.Rhenania Patent: DE99469 ; |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2,2,2-Trichlor-1-tert-pentyloxy-aethanol |
| Chloral-tert.-amylalkoholat |
| Amylenechloral |
| 1-(tert-Pentyloxy)-2,2,2-trichloroethanol |
| Trichloracetaldehyd-mono-tert.-amylacetal |
| 2,2,2-trichloro-1-tert-pentyloxy-ethanol |
| Dimethylaethylcarbinol-chloral |
| 2,2,2-trichloro-1-(1,1-dimethyl-propoxy)-ethanol |
| Dormiol |
| ETHANOL,1-(tert-PENTYLOXY)-2,2,2-TRICHLORO |