2-(chloromethyl)-1-(3-chloropropoxy)-4-tert-butyl-benzene structure
|
Common Name | 2-(chloromethyl)-1-(3-chloropropoxy)-4-tert-butyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 5409-88-1 | Molecular Weight | 275.21400 | |
| Density | 1.091g/cm3 | Boiling Point | 354.5ºC at 760 mmHg | |
| Molecular Formula | C14H20Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 58.2ºC | |
| Name | 4-tert-butyl-2-(chloromethyl)-1-(3-chloropropoxy)benzene |
|---|
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 354.5ºC at 760 mmHg |
| Molecular Formula | C14H20Cl2O |
| Molecular Weight | 275.21400 |
| Flash Point | 58.2ºC |
| Exact Mass | 274.08900 |
| PSA | 9.23000 |
| LogP | 4.73060 |
| Index of Refraction | 1.508 |
| InChIKey | UEOSBVUFSHCCGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OCCCCl)c(CCl)c1 |
|
~%
2-(chloromethyl... CAS#:5409-88-1 |
| Literature: Kulka Journal of Organic Chemistry, 1957 , vol. 22, p. 241,242 |
|
~%
2-(chloromethyl... CAS#:5409-88-1 |
| Literature: Kulka Journal of Organic Chemistry, 1957 , vol. 22, p. 241,242 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |