3-dimethylamino-1-(4-phenylphenyl)propan-1-one structure
|
Common Name | 3-dimethylamino-1-(4-phenylphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5409-63-2 | Molecular Weight | 289.80000 | |
| Density | 1.042g/cm3 | Boiling Point | 390.8ºC at 760 mmHg | |
| Molecular Formula | C17H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.4ºC | |
| Name | 3-(dimethylamino)-1-(4-phenylphenyl)propan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760 mmHg |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.80000 |
| Flash Point | 144.4ºC |
| Exact Mass | 289.12300 |
| PSA | 20.31000 |
| LogP | 4.29000 |
| Index of Refraction | 1.559 |
| InChIKey | ZLBBNTLIRYOJMR-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1ccc(-c2ccccc2)cc1.Cl |
|
~%
3-dimethylamino... CAS#:5409-63-2 |
| Literature: Japan Tobacco Inc. Patent: EP885869 A1, 1998 ; |
|
~26%
3-dimethylamino... CAS#:5409-63-2 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| 1-(4-biphenyl-1-yl)-3-dimethylamino-1-propanone hydrochloride |
| 1-biphenyl-4-yl-3-dimethylamino-propan-1-one,hydrochloride |
| 1-Biphenyl-4-yl-3-dimethylamino-propan-1-on,Hydrochlorid |
| 4'-phenyl-3-(dimethylamino)propiophenone hydrochloride |
| 3-dimethylamino-4'-phenylpropiophenone hydrochloride |