N,N-bis(4-chlorophenyl)-2-methyl-2-nitro-propane-1,3-diamine structure
|
Common Name | N,N-bis(4-chlorophenyl)-2-methyl-2-nitro-propane-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 5409-61-0 | Molecular Weight | 354.23100 | |
| Density | 1.367g/cm3 | Boiling Point | 569.6ºC at 760 mmHg | |
| Molecular Formula | C16H17Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.3ºC | |
| Name | N,N'-bis(4-chlorophenyl)-2-methyl-2-nitropropane-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 569.6ºC at 760 mmHg |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.23100 |
| Flash Point | 298.3ºC |
| Exact Mass | 353.07000 |
| PSA | 69.88000 |
| LogP | 5.22200 |
| Index of Refraction | 1.652 |
| InChIKey | HBBMRZZBXBDGHN-UHFFFAOYSA-N |
| SMILES | CC(CNc1ccc(Cl)cc1)(CNc1ccc(Cl)cc1)[N+](=O)[O-] |
| HS Code | 2921590090 |
|---|
|
~%
N,N-bis(4-chlor... CAS#:5409-61-0 |
| Literature: Comm.Solv.Corp. Patent: US2447653 , 1945 ; |
|
~%
N,N-bis(4-chlor... CAS#:5409-61-0 |
| Literature: Comm.Solv.Corp. Patent: US2447653 , 1945 ; |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms3078n05 |