1-(3,5-dibromo-4-hydroxy-phenyl)pentan-1-one structure
|
Common Name | 1-(3,5-dibromo-4-hydroxy-phenyl)pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5408-44-6 | Molecular Weight | 336.02000 | |
| Density | 1.669g/cm3 | Boiling Point | 374.4ºC at 760 mmHg | |
| Molecular Formula | C11H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2ºC | |
| Name | 1-(3,5-dibromo-4-hydroxyphenyl)pentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.669g/cm3 |
|---|---|
| Boiling Point | 374.4ºC at 760 mmHg |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02000 |
| Flash Point | 180.2ºC |
| Exact Mass | 333.92000 |
| PSA | 37.30000 |
| LogP | 4.29010 |
| Index of Refraction | 1.584 |
| InChIKey | SQZFPBSQOUVUJT-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)c1cc(Br)c(O)c(Br)c1 |
|
~%
1-(3,5-dibromo-... CAS#:5408-44-6 |
| Literature: Olusanjo, Moniola S.; Mashru, Shreena N.; Cartledge, Timothy; Ahmed, Sabbir Letters in Drug Design and Discovery, 2012 , vol. 9, # 6 p. 604 - 610 |
|
~%
1-(3,5-dibromo-... CAS#:5408-44-6 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1954 , p. 1034,1037 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-<3,5-Dibrom-2-hydroxy-phenyl>-propan-1-on |
| 2,4-Dihydroxy-3,5-dibrompropiophenon |
| 4,6-Dibrom-2-propionyl-phenol |
| 3',5'-dibromo-2'-hydroxy-propiophenone |