Nadoxolol structure
|
Common Name | Nadoxolol | ||
|---|---|---|---|---|
| CAS Number | 54063-51-3 | Molecular Weight | 260.28800 | |
| Density | 1.27g/cm3 | Boiling Point | 550.1ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.5ºC | |
| Name | N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 550.1ºC at 760 mmHg |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.28800 |
| Flash Point | 286.5ºC |
| Exact Mass | 260.11600 |
| PSA | 88.07000 |
| LogP | 2.41630 |
| Index of Refraction | 1.604 |
| InChIKey | UPZVYDSBLFNMLK-UHFFFAOYSA-N |
| SMILES | NC(CC(O)COc1cccc2ccccc12)=NO |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Nadoxololum |
| Nadoxololum [Latin] |
| UNII-SK43HU1689 |
| LL-1530 |
| Nadoxolol |
| (-)-3-Hydroxy-4-(1-naphtyloxy)butyramidoxim |