Biclofibrate
Modify Date: 2025-08-30 16:45:36
Biclofibrate structure
|
Common Name | Biclofibrate | ||
|---|---|---|---|---|
| CAS Number | 54063-27-3 | Molecular Weight | 410.29100 | |
| Density | 1.288g/cm3 | Boiling Point | 537.2ºC at 760mmHg | |
| Molecular Formula | C20H21Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.7ºC | |
| Name | 1-pyrrolidin-2-ylethyl 2,2-bis(4-chlorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 537.2ºC at 760mmHg |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.29100 |
| Flash Point | 278.7ºC |
| Exact Mass | 409.08500 |
| PSA | 48.00000 |
| LogP | 4.35260 |
| Index of Refraction | 1.571 |
| InChIKey | JAXUFJQVMKFWNB-UHFFFAOYSA-N |
| SMILES | CN1CCCC1COC(=O)C(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(pyrrolidin-2-yl)ethyl bis(4-chlorophenoxy)acetate |
| 1-Methylpyrrolidin-2-ylmethyl bis(4-chlorphenoxy)acetat |
| Biclofibrato |
| Biclofibrat |
| UNII-73U81R979T |
| Biclofibratum |