(2,4,6-tribromophenyl) carbonochloridate structure
|
Common Name | (2,4,6-tribromophenyl) carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 54060-68-3 | Molecular Weight | 393.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2Br3ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,6-tribromophenyl) carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H2Br3ClO2 |
|---|---|
| Molecular Weight | 393.25500 |
| Exact Mass | 389.72900 |
| PSA | 26.30000 |
| LogP | 4.71170 |
| InChIKey | DATCLDWYUKJLGL-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Oc1c(Br)cc(Br)cc1Br |
|
~%
(2,4,6-tribromo... CAS#:54060-68-3 |
| Literature: Raiford; Inman Journal of the American Chemical Society, 1934 , vol. 56, p. 1586,1587 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (2.4.6-Tribrom-phenyl)-chlorformiat |
| 2.4.6-Tribrom-1-chlorformyloxy-benzol |
| Carbonochloridic acid,2,4,6-tribromophenyl ester |
| Chlorameisensaeure-(2.4.6-tribrom-phenylester) |
| Kohlensaeure-(2.4.6-tribrom-phenylester)-chlorid |
| Chlorokohlensaeure-(2,4,6-tribrom-phenylester) |
| chlorocarbonic acid-(2,4,6-tribromo-phenyl ester) |