ethyl 2-(3-methyl-2-oxo-cyclohexyl)-2-oxo-acetate
Modify Date: 2025-09-27 18:21:24
ethyl 2-(3-methyl-2-oxo-cyclohexyl)-2-oxo-acetate structure
|
Common Name | ethyl 2-(3-methyl-2-oxo-cyclohexyl)-2-oxo-acetate | ||
|---|---|---|---|---|
| CAS Number | 5406-96-2 | Molecular Weight | 212.24200 | |
| Density | 1.113g/cm3 | Boiling Point | 323.9ºC at 760 mmHg | |
| Molecular Formula | C11H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.7ºC | |
| Name | ethyl 2-(3-methyl-2-oxocyclohexyl)-2-oxoacetate |
|---|
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 323.9ºC at 760 mmHg |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24200 |
| Flash Point | 141.7ºC |
| Exact Mass | 212.10500 |
| PSA | 60.44000 |
| LogP | 1.12390 |
| Index of Refraction | 1.465 |
| InChIKey | GNGXPOLCIGNAFB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1CCCC(C)C1=O |
| HS Code | 2918300090 |
|---|
|
~%
ethyl 2-(3-meth... CAS#:5406-96-2 |
| Literature: Koetz; Michels Justus Liebigs Annalen der Chemie, 1906 , vol. 348, p. 96 Justus Liebigs Annalen der Chemie, 1906 , vol. 350, p. 216 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |