9H-Fluorene-1-carboxylicacid, 9-oxo-, methyl ester
Modify Date: 2025-08-26 23:29:07
9H-Fluorene-1-carboxylicacid, 9-oxo-, methyl ester structure
|
Common Name | 9H-Fluorene-1-carboxylicacid, 9-oxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5406-90-6 | Molecular Weight | 238.23800 | |
| Density | 1.303g/cm3 | Boiling Point | 421.5ºC at 760mmHg | |
| Molecular Formula | C15H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | methyl 9-oxofluorene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 421.5ºC at 760mmHg |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.23800 |
| Flash Point | 190.3ºC |
| Exact Mass | 238.06300 |
| PSA | 43.37000 |
| LogP | 2.68460 |
| Index of Refraction | 1.638 |
| InChIKey | MDCCMRBQNJERFV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2c1C(=O)c1ccccc1-2 |
| HS Code | 2918300090 |
|---|
|
~%
9H-Fluorene-1-c... CAS#:5406-90-6 |
| Literature: Goldschmiedt; Lipschitz Monatshefte fuer Chemie, 1904 , vol. 25, p. 1174 |
|
~%
9H-Fluorene-1-c... CAS#:5406-90-6 |
| Literature: Bergmann; Orchin Journal of the American Chemical Society, 1949 , vol. 71, p. 1111 |
|
~%
9H-Fluorene-1-c... CAS#:5406-90-6 |
| Literature: Goldschmiedt; Lipschitz Monatshefte fuer Chemie, 1904 , vol. 25, p. 1174 |
|
~%
9H-Fluorene-1-c... CAS#:5406-90-6 |
| Literature: Goldschmiedt; Lipschitz Monatshefte fuer Chemie, 1904 , vol. 25, p. 1174 |
CAS#:65223-19-0| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| methyl 9-fluorenone-1-carboxylate |
| 9-Oxofluoren-1-carbonsaeuremethylester |
| Methyl 9-oxo-9H-fluorene-1-carboxylate |
| 9-oxo-fluorene-1-carboxylic acid methyl ester |
| HMS1432B14 |
| 9-fluorenone-1-carboxylic acid methyl ester |
| 1-methoxycarbonyl-9-fluorenone |