ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate structure
|
Common Name | ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 5406-47-3 | Molecular Weight | 216.27400 | |
| Density | 0.985g/cm3 | Boiling Point | 252.6ºC at 760 mmHg | |
| Molecular Formula | C11H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.4ºC | |
| Name | ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.985g/cm3 |
|---|---|
| Boiling Point | 252.6ºC at 760 mmHg |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.27400 |
| Flash Point | 102.4ºC |
| Exact Mass | 216.13600 |
| PSA | 44.76000 |
| LogP | 1.72880 |
| Index of Refraction | 1.423 |
| InChIKey | MTNKPBYWJDVJMA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(C)OCC(C)(C)CO1 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-dioxane-2-acetic acid,2,5,5-trimethyl-,ethyl ester |
| (2,5,5-trimethyl-[1,3]dioxan-2-yl)-acetic acid ethyl ester |
| ethyl (2,5,5-trimethyl-1,3-dioxan-2-yl)acetate |