4(1H)-Pteridinone,2,3-dihydro-6,7-dimethyl-2-thioxo- structure
|
Common Name | 4(1H)-Pteridinone,2,3-dihydro-6,7-dimethyl-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 54030-51-2 | Molecular Weight | 208.24000 | |
| Density | 1.49g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H8N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,7-dimethyl-2-sulfanylidene-1H-pteridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.24000 |
| Exact Mass | 208.04200 |
| PSA | 110.59000 |
| LogP | 1.03090 |
| Index of Refraction | 1.691 |
| InChIKey | FMPVXDGAZOSEMT-UHFFFAOYSA-N |
| SMILES | Cc1nc2[nH]c(=S)[nH]c(=O)c2nc1C |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-DIMETHYL-4-HYDROXY-2-MERCAPTOPTERIDINE |
| 6,7-Dimethyl-2-thioxo-2,3-dihydro-1H-pteridin-4-on |
| 6,7-dimethyl-1,2-dihydro-2-thioxopteridin-4(3H)-one |
| 6,7-dimethyl-2-thioxo-2,3-dihydropteridin-4(1H)-one |
| 6,7-Dimethyl-4-oxo-2-thioxotetrahydropteridin |
| 4-hydroxy-2-mercapto-6,7-dimethylpteridine |
| 6,7-dimethyl-2-thioxo-2,3-dihydro-1H-pteridin-4-one |