1-Amino-2-nitro-4-methoxy-O-methyl-benzene
Modify Date: 2025-08-26 11:39:16
1-Amino-2-nitro-4-methoxy-O-methyl-benzene structure
|
Common Name | 1-Amino-2-nitro-4-methoxy-O-methyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 54029-61-7 | Molecular Weight | 198.17600 | |
| Density | 1.317g/cm3 | Boiling Point | 375ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 1-Amino-2-nitro-4-methoxy-O-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 375ºC at 760 mmHg |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.17600 |
| Flash Point | 180.6ºC |
| Exact Mass | 198.06400 |
| PSA | 90.30000 |
| LogP | 2.26410 |
| Index of Refraction | 1.58 |
| InChIKey | JYMLEEMEKCPXBF-UHFFFAOYSA-N |
| SMILES | COCOc1ccc(N)c([N+](=O)[O-])c1 |
| HS Code | 2922199090 |
|---|
|
~61%
1-Amino-2-nitro... CAS#:54029-61-7 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1174028 A1, 2002 ; Location in patent: Example 28 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(Methoxymethoxy)-2-nitroaniline |