1-(2-fluoro-5-methyl-phenyl)-3-phenyl-urea
Modify Date: 2025-08-30 18:50:52
1-(2-fluoro-5-methyl-phenyl)-3-phenyl-urea structure
|
Common Name | 1-(2-fluoro-5-methyl-phenyl)-3-phenyl-urea | ||
|---|---|---|---|---|
| CAS Number | 5402-85-7 | Molecular Weight | 369.30000 | |
| Density | 1.283g/cm3 | Boiling Point | 273.9ºC at 760 mmHg | |
| Molecular Formula | C16H25BrN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.5ºC | |
| Name | 1-(2-fluoro-5-methyl-phenyl)-3-phenyl-urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 273.9ºC at 760 mmHg |
| Molecular Formula | C16H25BrN4O |
| Molecular Weight | 369.30000 |
| Flash Point | 119.5ºC |
| Exact Mass | 368.12100 |
| PSA | 51.63000 |
| LogP | 2.87520 |
| Index of Refraction | 1.655 |
| InChIKey | YORFCKNWAAOANP-UHFFFAOYSA-N |
| SMILES | Br.CN(C)CC(CN(C)C)Nc1ccnc2ccc(O)cc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2.4-Dioxy-benzophenon-anil |
| 4-(methylsulfanyl-phenyl-methylene)-morpholinium,iodide |
| 2,4-Dihydroxy-benzophenon-phenylimin |
| (E)-4-(phenyl-phenyliminomethyl)benzene-1,3-diol |
| 4-[phenyl(phenylimino)methyl]-1,3-benzenediol |