2,2,4-trimethyl-1-phenylpentane-1-thione structure
|
Common Name | 2,2,4-trimethyl-1-phenylpentane-1-thione | ||
|---|---|---|---|---|
| CAS Number | 54007-72-6 | Molecular Weight | 220.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4-trimethyl-1-phenylpentane-1-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20S |
|---|---|
| Molecular Weight | 220.37400 |
| Exact Mass | 220.12900 |
| PSA | 32.09000 |
| LogP | 4.47690 |
| InChIKey | FAKNAESOSQUTLF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(C)C(=S)c1ccccc1 |
|
~%
2,2,4-trimethyl... CAS#:54007-72-6 |
| Literature: Couture,A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 6218 - 6225 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1-Pentanethione,2,2,4-trimethyl-1-phenyl |
| 1-Phenyl-2,2,4-trimethyl-pentan-1-thion |
| 1-Phenyl-2,2,4-trimethyl-1-pentanthion |