1,2,3-Propanetricarboxylicacid, 1,2,3-tris(2-ethylhexyl) ester
Modify Date: 2025-08-25 13:09:34
1,2,3-Propanetricarboxylicacid, 1,2,3-tris(2-ethylhexyl) ester structure
|
Common Name | 1,2,3-Propanetricarboxylicacid, 1,2,3-tris(2-ethylhexyl) ester | ||
|---|---|---|---|---|
| CAS Number | 5400-99-7 | Molecular Weight | 512.76200 | |
| Density | 0.957g/cm3 | Boiling Point | 552.8ºC at 760 mmHg | |
| Molecular Formula | C30H56O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | tris(2-ethylhexyl) propane-1,2,3-tricarboxylate |
|---|
| Density | 0.957g/cm3 |
|---|---|
| Boiling Point | 552.8ºC at 760 mmHg |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.76200 |
| Flash Point | 225.7ºC |
| Exact Mass | 512.40800 |
| PSA | 78.90000 |
| LogP | 7.66160 |
| Index of Refraction | 1.458 |
| InChIKey | QSCYQUYIUCNAEV-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |