GLYCINE-P-NITROANILIDE structure
|
Common Name | GLYCINE-P-NITROANILIDE | ||
|---|---|---|---|---|
| CAS Number | 53987-32-9 | Molecular Weight | 195.17500 | |
| Density | 1.428g/cm3 | Boiling Point | 475.4ºC at 760mmHg | |
| Molecular Formula | C8H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | N-(2-amino-4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760mmHg |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.17500 |
| Flash Point | 241.3ºC |
| Exact Mass | 195.06400 |
| PSA | 104.43000 |
| LogP | 2.88930 |
| Index of Refraction | 1.674 |
| InChIKey | OSPPRBGGVRKEJL-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1N |
| HS Code | 2924299090 |
|---|
|
~82%
GLYCINE-P-NITRO... CAS#:53987-32-9 |
| Literature: Olguin, Luis F.; Jimenez-Estrada, Manuel; Barzana, Eduardo; Navarro-Ocana, Arturo Synlett, 2005 , # 2 art. no. S09204ST, p. 340 - 342 |
|
~%
GLYCINE-P-NITRO... CAS#:53987-32-9 |
| Literature: Olguin, Luis F.; Jimenez-Estrada, Manuel; Barzana, Eduardo; Navarro-Ocana, Arturo Synlett, 2005 , # 2 art. no. S09204ST, p. 340 - 342 |
|
~%
GLYCINE-P-NITRO... CAS#:53987-32-9 |
| Literature: Phillips Journal of the Chemical Society, 1930 , p. 1409,1413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 258-900-6 |
| 4-nitro-2-aminoacetanilide |
| GLYCINE-p-NITROANILIDE |
| 2'-Amino-4'-nitroacetanilid |
| acetic acid-(2-amino-4-nitro-anilide) |
| 5-Nitro-2-acetylaminoanilin |
| Acetamide,N-(2-amino-4-nitrophenyl) |
| H-Gly-pNA |
| Essigsaeure-(2-amino-4-nitro-anilid) |
| 4-Nitro-N1-acetyl-o-phenylendiamin |