Propanedioic acid,2-hexyl-, 1,3-diethyl ester
Modify Date: 2025-08-20 15:30:45
Propanedioic acid,2-hexyl-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-hexyl-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5398-10-7 | Molecular Weight | 244.32700 | |
| Density | 0.975g/cm3 | Boiling Point | 269ºC at 760mmHg | |
| Molecular Formula | C13H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.7ºC | |
| Name | diethyl 2-hexylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 269ºC at 760mmHg |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.32700 |
| Flash Point | 122.7ºC |
| Exact Mass | 244.16700 |
| PSA | 52.60000 |
| LogP | 2.69920 |
| Index of Refraction | 1.438 |
| InChIKey | HSHMTDVEKPAEGS-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hexylmalonic acid diethyl ester |
| ethyl 2-ethoxycarbonyloctanoate |
| Diethyl 2-hexylmalonate |
| Diethyl hexylmalonate |
| diethyl n-hexylmalonate |
| Propanedioic acid,hexyl-,diethyl ester |
| Hexylmalonsaeure-diethylester |
| 2-hexanepropanedioic acid diethyl ester |