trimethyl-[(2,3,4,6-tetramethylphenyl)methyl]azanium structure
|
Common Name | trimethyl-[(2,3,4,6-tetramethylphenyl)methyl]azanium | ||
|---|---|---|---|---|
| CAS Number | 5398-01-6 | Molecular Weight | 241.80000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[(2,3,4,6-tetramethylphenyl)methyl]azanium,chloride |
|---|
| Molecular Formula | C14H24ClN |
|---|---|
| Molecular Weight | 241.80000 |
| Exact Mass | 241.16000 |
| LogP | 0.13040 |
| InChIKey | FKOBRGCOCFTSPZ-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)c(C[N+](C)(C)C)c(C)c1C.[Cl-] |
| HS Code | 2923900090 |
|---|
|
~%
trimethyl-[(2,3... CAS#:5398-01-6 |
| Literature: Hauser; Van Eenam Journal of Organic Chemistry, 1958 , vol. 23, p. 865,869 Journal of the American Chemical Society, vol. 79, p. 6282 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |