N-(3-chlorophenyl)-3-ethyl-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine structure
|
Common Name | N-(3-chlorophenyl)-3-ethyl-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine | ||
|---|---|---|---|---|
| CAS Number | 5395-46-0 | Molecular Weight | 349.81700 | |
| Density | 1.33g/cm3 | Boiling Point | 446.5ºC at 760 mmHg | |
| Molecular Formula | C19H16ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | 4-(3-chloroanilino)-6-ethyl-1-phenyl-1h-pyrazolo[3,4-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 446.5ºC at 760 mmHg |
| Molecular Formula | C19H16ClN5 |
| Molecular Weight | 349.81700 |
| Flash Point | 223.8ºC |
| Exact Mass | 349.10900 |
| PSA | 55.63000 |
| LogP | 4.84790 |
| Index of Refraction | 1.691 |
| InChIKey | OXFWMQVBOPWXSU-UHFFFAOYSA-N |
| SMILES | CCc1nc(Nc2cccc(Cl)c2)c2cnn(-c3ccccc3)c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (6-ethyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-(2,5-dichloro-phenyl)-amine |
| (6-Aethyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-(3-chlor-phenyl)-amin |
| (6-Aethyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-(2,5-dichlor-phenyl)-amin |
| (6-ethyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-(3-chloro-phenyl)-amine |