methyl 3-hydroxy-4-nitro-naphthalene-2-carboxylate
Modify Date: 2024-09-17 11:27:41
methyl 3-hydroxy-4-nitro-naphthalene-2-carboxylate structure
|
Common Name | methyl 3-hydroxy-4-nitro-naphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5394-81-0 | Molecular Weight | 247.20400 | |
| Density | 1.439g/cm3 | Boiling Point | 361.5ºC at 760 mmHg | |
| Molecular Formula | C12H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | methyl 3-hydroxy-4-nitronaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 361.5ºC at 760 mmHg |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.20400 |
| Flash Point | 172.4ºC |
| Exact Mass | 247.04800 |
| PSA | 92.35000 |
| LogP | 2.76340 |
| Index of Refraction | 1.672 |
| InChIKey | SMEAMGOZNIOEDU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2ccccc2c([N+](=O)[O-])c1O |
| HS Code | 2918199090 |
|---|
|
~53%
methyl 3-hydrox... CAS#:5394-81-0 |
| Literature: Xie, Fuchun; Li, Bingbing X.; Xiao, Xiangshu Letters in Organic Chemistry, 2013 , vol. 10, # 5 p. 380 - 384 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:104655-33-6
CAS#:88-99-3| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Hydroxy-4-nitro-[2]naphthoesaeure-methylester |
| 3-HYDROXY-4-NITRO-2-NAPHTHOIC ACID,METHYL ESTER |
| methyl 3-hydroxy-4-nitro-2-naphthoate |