Carbanilic acid,p-[p-(dimethylamino)cinnamoyl]-, ethyl ester (8CI) structure
|
Common Name | Carbanilic acid,p-[p-(dimethylamino)cinnamoyl]-, ethyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 5394-70-7 | Molecular Weight | 338.40000 | |
| Density | 1.192g/cm3 | Boiling Point | 487.3ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.5ºC | |
| Name | [4-(4-dimethylamino-trans-cinnamoyl)-phenyl]-carbamic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 487.3ºC at 760 mmHg |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.40000 |
| Flash Point | 248.5ºC |
| Exact Mass | 338.16300 |
| PSA | 58.64000 |
| LogP | 4.29010 |
| Index of Refraction | 1.638 |
| InChIKey | MPPMVGNGOBRSCS-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(O)c1ccc(C(=O)C=Cc2ccc(N(C)C)cc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-{(e)-[4-(dimethylamino)phenyl]diazenyl}phenyl)arsonic acid |
| (Benzol-arsinsaeure-(4))-(1 azo 4)-(N.N-dimethyl-anilin) |
| p-((p-(Dimethylamino)phenyl)azo)benzenearsonic acid |
| 4-Dimethylaminoazobenzene arsonic acid |
| 4-Dimethylamino-4'-arsono-azobenzol |
| [4-(4-Dimethylamino-phenylazo)-phenyl]-arsonsaeure |
| 4-(Dimethylamino)azobenzene-4'-arsonic acid |
| [4-(4-Dimethylamino-trans-cinnamoyl)-phenyl]-carbamidsaeure-aethylester |
| 4-Dimethylamino-azobenzol-arsinsaeure-(4') |
| 4-Dimethylamino-azobenzol-4'-arsonsaeure |
| 4-(4-Dimethylaminophenylazo)phenylarsonic acid |
| p-Dimethylaminophenylazophenylarsonic acid |