N-(3-Chloropropyl)-N-(3-ethoxy-3-oxopropyl)-β-alanine ethyl ester
Modify Date: 2025-09-10 16:47:33
N-(3-Chloropropyl)-N-(3-ethoxy-3-oxopropyl)-β-alanine ethyl ester structure
|
Common Name | N-(3-Chloropropyl)-N-(3-ethoxy-3-oxopropyl)-β-alanine ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 53935-67-4 | Molecular Weight | 293.78700 | |
| Density | 1.093g/cm3 | Boiling Point | 367.8ºC at 760 mmHg | |
| Molecular Formula | C13H24ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.2ºC | |
| Name | ethyl 3-[3-chloropropyl-(3-ethoxy-3-oxopropyl)amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 367.8ºC at 760 mmHg |
| Molecular Formula | C13H24ClNO4 |
| Molecular Weight | 293.78700 |
| Flash Point | 176.2ºC |
| Exact Mass | 293.13900 |
| PSA | 55.84000 |
| LogP | 1.82370 |
| Index of Refraction | 1.465 |
| HS Code | 2922499990 |
|---|
|
~%
N-(3-Chloroprop... CAS#:53935-67-4 |
| Literature: Wadsworth,D.H. Journal of Organic Chemistry, 1967 , vol. 32, p. 1184 - 1187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| ETHYL 3-(3-CHLOROPROPYL-(2-ETHOXYCARBONYLETHYL)AMINO)PROPANOATE |
| Diethyl-N-<3-chlor-propyl>-3,3'-iminopropionat |
| Diethyl N-(3-chloropropyl)imino-3,3'-dipropionate |
| diethyl 3,3'-[(3-chloropropyl)imino]dipropanoate(non-preferred name) |